| Company Name: |
Anhui Sholon New Material Technology Co., Ltd.
|
| Tel: |
0550-5261666 19901505185 |
| Email: |
sales@sholonchem.com |
| Products Intro: |
Product Name:1,3,5-Triazine, 2-(3-chloro-1-dibenzofuranyl)-4,6-diphenyl-
CAS:2247123-78-8
Purity:0.99 Package:1KG,10KG,100KG
|
|
| | 1,3,5-Triazine, 2-(3-chloro-1-dibenzofuranyl)-4,6-diphenyl- Basic information |
| Product Name: | 1,3,5-Triazine, 2-(3-chloro-1-dibenzofuranyl)-4,6-diphenyl- | | Synonyms: | 1,3,5-Triazine, 2-(3-chloro-1-dibenzofuranyl)-4,6-diphenyl-;2-(3-chloro-1-dibenzofuranyl)-4,6-diphenyl-1,3,5-Triazine;2-(3-chlorodibenzo[b,d]furan-1-yl)-4,6-diphenyl-1,3,5-triazine | | CAS: | 2247123-78-8 | | MF: | C27H16ClN3O | | MW: | 433.89 | | EINECS: | | | Product Categories: | | | Mol File: | 2247123-78-8.mol |  |
| | 1,3,5-Triazine, 2-(3-chloro-1-dibenzofuranyl)-4,6-diphenyl- Chemical Properties |
| Boiling point | 684.9±65.0 °C(Predicted) | | density | 1.323±0.06 g/cm3(Predicted) | | pka | 0.01±0.10(Predicted) | | InChI | InChI=1S/C27H16ClN3O/c28-19-15-21(24-20-13-7-8-14-22(20)32-23(24)16-19)27-30-25(17-9-3-1-4-10-17)29-26(31-27)18-11-5-2-6-12-18/h1-16H | | InChIKey | KRJLXQPTUDJDIU-UHFFFAOYSA-N | | SMILES | N1=C(C2=CC=CC=C2)N=C(C2=CC=CC=C2)N=C1C1=C2C3=CC=CC=C3OC2=CC(Cl)=C1 |
| | 1,3,5-Triazine, 2-(3-chloro-1-dibenzofuranyl)-4,6-diphenyl- Usage And Synthesis |
| Definition |
1,3,5-Triazine, 2-(3-chloro-1-dibenzofuranyl)-4,6-diphenyl-, a derivative of 1,3,5-Triazine, is a useful compound. The 1,3,5-triazine core is widely encountered in organic chemistry, medicinal chemistry, photochemistry and even cosmetics. It appears as one of the leading motifs in many compounds with potential biological activity in anti-cancer, antibacterial, antiviral, anti-inflammatory, antimalarial agents, etc[1].
| | References | [1] Damian Ku?aga . “Green synthesis of 1,3,5-triazine derivatives using a sonochemical protocol.” Ultrasonics Sonochemistry 108 (2024): Article 106951.
|
| | 1,3,5-Triazine, 2-(3-chloro-1-dibenzofuranyl)-4,6-diphenyl- Preparation Products And Raw materials |
|