|
|
| | 1-Benzyl-3-phenyl-2-thiourea Basic information |
| Product Name: | 1-Benzyl-3-phenyl-2-thiourea | | Synonyms: | 1-Benzyl-3-phenylthiourea;N-Benzyl-N'-phenylthiourea;N-Phenyl-N'-benzylthiourea;Thiourea, N-phenyl-N'-(phenylmethyl)-;1-Phenyl-3-benzylthiourea;1-BENZYL-3-PHENYL-2-THIOUREA;(E)-N-benzyl-N-phenylcarbamimidothioic acid | | CAS: | 726-25-0 | | MF: | C14H14N2S | | MW: | 242.34 | | EINECS: | | | Product Categories: | | | Mol File: | 726-25-0.mol |  |
| | 1-Benzyl-3-phenyl-2-thiourea Chemical Properties |
| Melting point | 156-158°C | | Boiling point | 377.7±35.0 °C(Predicted) | | density | 1.212±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 12.68±0.70(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C14H14N2S/c17-14(16-13-9-5-2-6-10-13)15-11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,15,16,17) | | InChIKey | NXCBDDGSOXJEFZ-UHFFFAOYSA-N | | SMILES | N(C1=CC=CC=C1)C(NCC1=CC=CC=C1)=S | | CAS DataBase Reference | 726-25-0(CAS DataBase Reference) |
| RIDADR | UN 2811 6.1/PG III | | HS Code | 2930.90.2900 | | HazardClass | IRRITANT | | PackingGroup | III |
| | 1-Benzyl-3-phenyl-2-thiourea Usage And Synthesis |
| Description | 1-Benzyl-3-phenyl-2-thiourea (BPTU) is a thiourea derivative that contains benzene rings and polar groups. Its inhibition efficiency is related to the polar functions, acting as active centers for the adsorption. In addition, the presence of multiple benzene rings may increase the molecular coverage density. Therefore, BPTU is expected to become a potential corrosion inhibitor. The results showed that BPTU with a concentration of 2 × 10?4 M and at the temperature of 30°C could protect the steel surface with the highest inhibition efficiency of 94.99% and 94.30%. High temperature decreased BPTU’s ability to inhibit steel corrosion[1]. | | References |
[1] Quy Huong Dinh, Nam Pham Cam, Tran Duong. “A Study of 1-Benzyl-3-phenyl-2-thiourea as an Effective Steel Corrosion Inhibitor in 1.0 M HCl Solution.” New Journal of Chemistry 13 1 (2021): 1–14.
|
| | 1-Benzyl-3-phenyl-2-thiourea Preparation Products And Raw materials |
|