2,4-di-tert-butyl-5-nitrophenyl methyl carbonate
|
|
|
- CAS-Nr.
- 873055-55-1
- Englisch Name:
- 2,4-di-tert-butyl-5-nitrophenyl methyl carbonate
- Synonyma:
- IvacaftorImpurity4-d20;2,4-Di-Tert-Butyl-5-Nitrophenyl;,4-di-tert-butyl-5-nitrophenyl methyl carbonate;2,4-di-tert-butyl-5-nitrophenyl methyl carbonate;5-nitro-2,4-di-tert-butylphenyl methyl carbonate;2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester;Carbonicacid, 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methy...;Carbonic acid 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester;2,4-Di-tert-butyl-5-nitrophenyl methyl carbonate
Carbonic acid 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester;2,4-Di-tert-butyl-5-nitrophenyl-d10 Methyl CarbonateQ: What is
2,4-Di-tert-butyl-5-nitrophenyl-d10 Methyl Carbonate Q: What is the CAS Number of
2,4-Di-tert-butyl-5-nitrophenyl-d10 Methyl Carbonate
- CBNumber:
- CB71512314
- Summenformel:
- C16H23NO5
- Molgewicht:
- 309.36
- MOL-Datei:
- 873055-55-1.mol
|
2,4-di-tert-butyl-5-nitrophenyl methyl carbonate Eigenschaften
- Siedepunkt:
- 384℃
- Dichte
- 1.110
- Flammpunkt:
- 135℃
- InChI
- InChI=1S/C16H23NO5/c1-15(2,3)10-8-11(16(4,5)6)13(22-14(18)21-7)9-12(10)17(19)20/h8-9H,1-7H3
- InChIKey
- QBDLLAFFRJOLHZ-UHFFFAOYSA-N
- SMILES
- C(OC)(=O)OC1=CC([N+]([O-])=O)=C(C(C)(C)C)C=C1C(C)(C)C
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Bildanzeige (GHS) |
  
|
| Alarmwort |
Achtung |
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
![GHS hazard pictograms]() src="/GHS07.jpg" width="20" height="20" /> |
P264, P270, P301+P312, P330, P501 |
| H361 |
Kann vermutlich die Fruchtbarkeit beeintr?chtigen oder das Kind im Mutterleib sch?digen. |
Reproduktionstoxizit?t |
Kategorie 2 |
Warnung |
|
P201, P202, P281, P308+P313, P405,P501 |
| H372 |
Sch?digt bei Hautkontakt und Verschlucken die Organe bei l?ngerer oder wiederholter Exposition. |
Spezifische Zielorgan-Toxizit?t (wiederholte Exposition) |
Kategorie 1 |
Achtung |
![GHS hazard pictograms]() src="/GHS08.jpg" width="20" height="20" /> |
P260, P264, P270, P314, P501 |
| H410 |
Sehr giftig für Wasserorganismen mit langfristiger Wirkung. |
Langfristig (chronisch) gew?ssergef?hrdend |
Kategorie 1 |
Warnung |
![GHS hazard pictograms]() src="/GHS09.jpg" width="20" height="20" /> |
P273, P391, P501 |
|
| Sicherheit |
| P201 |
Vor Gebrauch besondere Anweisungen einholen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P301+P330+P331 |
BEI VERSCHLUCKEN: Mund ausspülen. KEIN Erbrechen herbeiführen. |
| P312 |
Bei Unwohlsein GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
|
2,4-di-tert-butyl-5-nitrophenyl methyl carbonate Chemische Eigenschaften,Einsatz,Produktion Methoden
2,4-di-tert-butyl-5-nitrophenyl methyl carbonate Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2,4-di-tert-butyl-5-nitrophenyl methyl carbonate Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 80)Lieferanten
- 2,4-di-tert-butyl-5-nitrophenyl methyl carbonate
- Carbonic acid 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester
- 2,4-Di-tert-butyl-5-nitrophenyl methyl carbonate
Carbonic acid 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester
- ,4-di-tert-butyl-5-nitrophenyl methyl carbonate
- 5-nitro-2,4-di-tert-butylphenyl methyl carbonate
- 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester
- 2,4-Di-Tert-Butyl-5-Nitrophenyl
- Carbonicacid, 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methy...
- 2,4-Di-tert-butyl-5-nitrophenyl-d10 Methyl CarbonateQ: What is
2,4-Di-tert-butyl-5-nitrophenyl-d10 Methyl Carbonate Q: What is the CAS Number of
2,4-Di-tert-butyl-5-nitrophenyl-d10 Methyl Carbonate
- IvacaftorImpurity4-d20
- 873055-55-1
