| Company Name: |
Borenpharm Co., Ltd
|
| Tel: |
027-65563561 |
| Email: |
sales@borenpharm.com |
| Products Intro: |
Product Name:Benzyl-PEG3-acid
CAS:127457-63-0
Purity:95% HPLC Package:1g; 5g Remarks:3.5g
|
Benzyl-PEG3-acid manufacturers
- Benzyl-PEG3-acid
-
- $0.00 / 100mg
-
2024-10-24
- CAS:127457-63-0
- Min. Order:
- Purity:
- Supply Ability: 10g
- Benzyl-PEG3-acid
-
- $0.00 / 1g
-
2024-03-25
- CAS:127457-63-0
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | Benzyl-PEG3-acid Basic information |
| Product Name: | Benzyl-PEG3-acid | | Synonyms: | Benzyl-PEG3-acid;3-(2-(2-(Benzyloxy)ethoxy)ethoxy)propanoicacid;BnO-PEG2-CH2CH2COOH;CAS_127457-63-0;BnO-(CH2CH2O)2-CH2CH2COOH;BnO-PEG2-CH2CH2COOH/Propanoic acid, 3-[2-[2-(phenylmethoxy)ethoxy]ethoxy]-;Propanoic acid, 3-[2-[2-(phenylmethoxy)ethoxy]ethoxy]- | | CAS: | 127457-63-0 | | MF: | C14H20O5 | | MW: | 268.31 | | EINECS: | | | Product Categories: | | | Mol File: | 127457-63-0.mol |  |
| | Benzyl-PEG3-acid Chemical Properties |
| Boiling point | 410.6±35.0 °C(Predicted) | | density | 1.141±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.28±0.10(Predicted) | | form | Liquid | | color | Light yellow to yellow |
| | Benzyl-PEG3-acid Usage And Synthesis |
| | Benzyl-PEG3-acid Preparation Products And Raw materials |
|