- Mal-PEG8-acid
-
- $0.00 / 1g
-
2024-03-27
- CAS:1818294-46-0
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | Mal-PEG8-acid Basic information |
| Product Name: | Mal-PEG8-acid | | Synonyms: | Maleimide-PEG8-CH2CH2COOH;Mal-PEG8-acid;Mal-PEG8-CH2CH2COOH;4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-;Mal-PEG8-CH2CH2COOH/4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-;3-[2-[2-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid | | CAS: | 1818294-46-0 | | MF: | C23H39NO12 | | MW: | 521.56 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1818294-46-0.mol |  |
| | Mal-PEG8-acid Chemical Properties |
| Boiling point | 634.6±55.0 °C(Predicted) | | density | 1.213±0.06 g/cm3(Predicted) | | solubility | Soluble in Water, DMSO, DCM, DMF | | pka | 4.28±0.10(Predicted) | | form | powder | | color | White | | InChI | InChI=1S/C23H39NO12/c25-21-1-2-22(26)24(21)4-6-30-8-10-32-12-14-34-16-18-36-20-19-35-17-15-33-13-11-31-9-7-29-5-3-23(27)28/h1-2H,3-20H2,(H,27,28) | | InChIKey | KLZPPWOSICDUKQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN1C(=O)C=CC1=O |
| | Mal-PEG8-acid Usage And Synthesis |
| Description | Mal-PEG8-acid is a PEG linker containing a maleimide group with a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. |
| | Mal-PEG8-acid Preparation Products And Raw materials |
|