|
|
| | 4'-Methyl-2-cyanobiphenyl Basic information |
| | 4'-Methyl-2-cyanobiphenyl Chemical Properties |
| Melting point | 49 °C | | Boiling point | >320°C | | density | 1,17 g/cm3 | | vapor pressure | 0.014Pa at 20℃ | | Fp | >320°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | color | Off-white to beige | | BRN | 3605954 | | InChI | InChI=1S/C14H11N/c1-11-6-8-12(9-7-11)14-5-3-2-4-13(14)10-15/h2-9H,1H3 | | InChIKey | ZGQVZLSNEBEHFN-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C)C=C2)=CC=CC=C1C#N | | LogP | 3.5 at 23℃ | | CAS DataBase Reference | 114772-53-1(CAS DataBase Reference) | | NIST Chemistry Reference | Benzonitrile, 2-(4-methylphenyl)-(114772-53-1) |
| | 4'-Methyl-2-cyanobiphenyl Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | 4'-Methylbiphenyl-2-carbonitrile is an intermediate in the synthesis of glycogen synthase kinase-3 inhibitors with a selective sting for glycogen synthase kinase 3α. | | Synthesis | 4'-Methyl-2-cyanobiphenyl is prepared by the reaction of o-cyanobromobenzene and potassium (4-methylphenyl)trifluoroborate. The specific synthesis steps are as follows:
General procedure: A mixture of aryl halide (0.5 mmol), potassium aryltrifluoroborate (0.6 mmol), K2CO3 (1.0 mmol), Pd/C (5%; 0.5 mol%), ethanol (3 mL), and distilled water (1 mL) was stirred at 80 °C in air for the time indicated.
The reaction mixture was added to brine (15 mL) and extracted with ethyl acetate (4×15 mL).
The organic solvent was removed under vacuum, and the product was isolated by short-column chromatography.
 |
| | 4'-Methyl-2-cyanobiphenyl Preparation Products And Raw materials |
|