|
|
| | 1-(3-AMINOPROPYL)-2-PYRROLIDINONE Basic information |
| | 1-(3-AMINOPROPYL)-2-PYRROLIDINONE Chemical Properties |
| Boiling point | 120-123 °C1 mm Hg(lit.) | | density | 1.014 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 9.85±0.10(Predicted) | | form | Liquid | | Specific Gravity | 1.01 | | color | Clear colorless to slightly brown | | InChI | InChI=1S/C7H14N2O/c8-4-2-6-9-5-1-3-7(9)10/h1-6,8H2 | | InChIKey | HJORCZCMNWLHMB-UHFFFAOYSA-N | | SMILES | N1(CCCN)CCCC1=O | | CAS DataBase Reference | 7663-77-6(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3267 8/PG 2 | | WGK Germany | 3 | | RTECS | UY5739500 | | F | 9-34 | | Hazard Note | Irritant | | HS Code | 29337900 |
| | 1-(3-AMINOPROPYL)-2-PYRROLIDINONE Usage And Synthesis |
| Chemical Properties | Clear Slightly Yellowish Liquid | | Uses | 1-(3-AMinopropyl)-2-pyrrolidinone can be used as a useful synthetic intermediate. | | Uses | N-(3-Aminopropyl)-2-pyrrolidinone was used in the simultaneous determination of total polyamines and three of their non?α? amino acid metabolites in urine by capillary gas-chromatographic method with nitrogen-phosphorus detection. | | General Description | N-(3-Aminopropyl)-2-pyrrolidinone (PYR) conjugates (VPA-PYR) of valproic acid (VA) have been investigated for their anticonvulsant activity in mice. It is the γ-lactam form of isoputreanine. |
| | 1-(3-AMINOPROPYL)-2-PYRROLIDINONE Preparation Products And Raw materials |
|