|
|
| | disodium methylenebisnaphthalenesulphonate Basic information | | Uses |
| Product Name: | disodium methylenebisnaphthalenesulphonate | | Synonyms: | disodium methylenebisnaphthalenesulphonate;DISODIUM METHYLENE DINAPHTHALENESULFONATE;Sodium Dinaphthylmethanedisulfonate;Naphthalenesulfonic acid, methylenebis-, disodium salt;SODIUMDINAPHTHYLMETHANEDISULPHONATE;SODIUMDINAPHTHYLMETHYLDISULPHONATE;methylenebis-naphthalenesulfonic acid disodium salt;sodium methylene naphthalene sulfonate | | CAS: | 26545-58-4 | | MF: | C21H14Na2O6S2 | | MW: | 472.4418 | | EINECS: | 247-785-8 | | Product Categories: | Organics;Intermediates of Dyes and Pigments | | Mol File: | 26545-58-4.mol |  |
| | disodium methylenebisnaphthalenesulphonate Chemical Properties |
| InChI | InChI=1S/C21H16O6S2.2Na.2H/c22-28(23,20-13-5-9-16-7-1-3-11-18(16)20)26-15-27-29(24,25)21-14-6-10-17-8-2-4-12-19(17)21;;;;/h1-14H,15H2;;;; | | InChIKey | BDOHCXZCMGUVKG-UHFFFAOYSA-N | | SMILES | [NaH].[NaH].C(OS(C1=C2C(C=CC=C2)=CC=C1)(=O)=O)OS(C1=C2C(C=CC=C2)=CC=C1)(=O)=O | | CAS DataBase Reference | 26545-58-4 | | EPA Substance Registry System | Disodium methylenebis[naphthalenesulfonate] (26545-58-4) |
| | disodium methylenebisnaphthalenesulphonate Usage And Synthesis |
| Uses | Disodium methylenebisnaphthalenesulfonate is a useful research chemical compound. | | Uses | Disodium Methylenebisnaphthalenesulfonate is a useful research chemical compound used as a dispersing agent in the dye industry. |
| | disodium methylenebisnaphthalenesulphonate Preparation Products And Raw materials |
|