Identification | Back Directory | [Name]
xylocytidine | [CAS]
3530-56-1 | [Synonyms]
xylocytidine Cytarabine Impurity 3 Azacitidine Impurity E 1-(b-D-Xylofuranosyl)cytosine 1-(β-D-Xylofuranosyl)cytosine 1-(beta-D-Xylofuranosyl)cytosine 1-(β-D-xylo-pentofuranosyl)cytosine 4-amino-1-((2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidin-2(1H)-one 1-(b-D-Xylofuranosyl) cytosine,Xylo-cytidine,Azacitidine Impurity 18 Azacitidine Impurity E, Cytarabine Impurity 3 | [Molecular Formula]
C9H13N3O5 | [MDL Number]
MFCD01689131 | [MOL File]
3530-56-1.mol | [Molecular Weight]
243.217 |
Chemical Properties | Back Directory | [Melting point ]
237-238 °C | [Boiling point ]
545.7±60.0 °C(Predicted) | [density ]
1.89±0.1 g/cm3(Predicted) | [pka]
13.48±0.70(Predicted) | [InChI]
InChI=1/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6+,7-,8-/s3 | [InChIKey]
UHDGCWIWMRVCDJ-QOUWCGOQNA-N | [SMILES]
C1(=O)N([C@H]2[C@H](O)[C@@H](O)[C@@H](CO)O2)C=CC(N)=N1 |&1:3,4,6,8,r| |
Hazard Information | Back Directory | [Description]
Xylocytidine is a cytidine analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities.
|
|
|